C16H14ClF6N5 — CID 86606161
6-chloro-2-N-(propan-2-ylideneamino)-5-(2,4,6-trifluorophenyl)-4-N-[(2S)-1,1,1-trifluoropropan-2-yl]pyrimidine-2,4-diamine (PubChem CID 86606161) has the molecular formula C16H14ClF6N5 and a molecular weight of 425.76 g/mol. Its IUPAC name is 6-chloro-2-N-(propan-2-ylideneamino)-5-(2,4,6-trifluorophenyl)-4-N-[(2S)-1,1,1-trifluoropropan-2-yl]pyrimidine-2,4-diamine.
| Compound Name | 6-chloro-2-N-(propan-2-ylideneamino)-5-(2,4,6-trifluorophenyl)-4-N-[(2S)-1,1,1-trifluoropropan-2-yl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 86606161 |
| Molecular Formula | C16H14ClF6N5 |
| Molecular Weight | 425.76 g/mol |
| Exact Mass | 425.08 |
| IUPAC Name | 6-chloro-2-N-(propan-2-ylideneamino)-5-(2,4,6-trifluorophenyl)-4-N-[(2S)-1,1,1-trifluoropropan-2-yl]pyrimidine-2,4-diamine |
| SMILES | CC(C)=NNc1nc(Cl)c(-c2c(F)cc(F)cc2F)c(N[C@@H](C)C(F)(F)F)n1 |
| InChI | InChI=1S/C16H14ClF6N5/c1-6(2)27-28-15-25-13(17)12(11-9(19)4-8(18)5-10(11)20)14(26-15)24-7(3)16(21,22)23/h4-5,7H,1-3H3,(H2,24,25,26,28)/t7-/m0/s1 |
| InChIKey | FIURRPCBPRLKSS-ZETCQYMHSA-N |
| XLogP | 5.38 |
| TPSA | 62.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.76 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|