C17H15ClF5N5O2 — CID 11430883
3-[4-[5-chloro-7-[[(2R)-1,1,1-trifluoropropan-2-yl]amino]-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]-3,5-difluorophenoxy]propan-1-ol (PubChem CID 11430883) has the molecular formula C17H15ClF5N5O2 and a molecular weight of 451.78 g/mol. Its IUPAC name is 3-[4-[5-chloro-7-[[(2R)-1,1,1-trifluoropropan-2-yl]amino]-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]-3,5-difluorophenoxy]propan-1-ol.
| Compound Name | 3-[4-[5-chloro-7-[[(2R)-1,1,1-trifluoropropan-2-yl]amino]-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]-3,5-difluorophenoxy]propan-1-ol |
|---|---|
| PubChem CID | 11430883 |
| Molecular Formula | C17H15ClF5N5O2 |
| Molecular Weight | 451.78 g/mol |
| Exact Mass | 451.08 |
| IUPAC Name | 3-[4-[5-chloro-7-[[(2R)-1,1,1-trifluoropropan-2-yl]amino]-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]-3,5-difluorophenoxy]propan-1-ol |
| SMILES | C[C@@H](Nc1c(-c2c(F)cc(OCCCO)cc2F)c(Cl)nc2ncnn12)C(F)(F)F |
| InChI | InChI=1S/C17H15ClF5N5O2/c1-8(17(21,22)23)26-15-13(14(18)27-16-24-7-25-28(15)16)12-10(19)5-9(6-11(12)20)30-4-2-3-29/h5-8,26,29H,2-4H2,1H3/t8-/m1/s1 |
| InChIKey | PYOBBMDUGURFMC-MRVPVSSYSA-N |
| XLogP | 3.85 |
| TPSA | 84.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.78 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|