C19H18ClF5N6O2 — CID 118292163
6-[4-[2-(3-aminooxetan-3-yl)ethoxy]-2,6-difluorophenyl]-5-chloro-N-[(2S)-1,1,1-trifluoropropan-2-yl]-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine (PubChem CID 118292163) has the molecular formula C19H18ClF5N6O2 and a molecular weight of 492.84 g/mol. Its IUPAC name is 6-[4-[2-(3-aminooxetan-3-yl)ethoxy]-2,6-difluorophenyl]-5-chloro-N-[(2S)-1,1,1-trifluoropropan-2-yl]-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | 6-[4-[2-(3-aminooxetan-3-yl)ethoxy]-2,6-difluorophenyl]-5-chloro-N-[(2S)-1,1,1-trifluoropropan-2-yl]-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 118292163 |
| Molecular Formula | C19H18ClF5N6O2 |
| Molecular Weight | 492.84 g/mol |
| Exact Mass | 492.11 |
| IUPAC Name | 6-[4-[2-(3-aminooxetan-3-yl)ethoxy]-2,6-difluorophenyl]-5-chloro-N-[(2S)-1,1,1-trifluoropropan-2-yl]-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
| SMILES | C[C@H](Nc1c(-c2c(F)cc(OCCC3(N)COC3)cc2F)c(Cl)nc2ncnn12)C(F)(F)F |
| InChI | InChI=1S/C19H18ClF5N6O2/c1-9(19(23,24)25)29-16-14(15(20)30-17-27-8-28-31(16)17)13-11(21)4-10(5-12(13)22)33-3-2-18(26)6-32-7-18/h4-5,8-9,29H,2-3,6-7,26H2,1H3/t9-/m0/s1 |
| InChIKey | LZGJJPSCVXXXEJ-VIFPVBQESA-N |
| XLogP | 3.58 |
| TPSA | 99.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.84 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |