C17H16ClF5N6O — CID 89203292
5-chloro-6-[2,6-difluoro-4-[1-(methylamino)ethoxy]phenyl]-N-[(2S)-1,1,1-trifluoropropan-2-yl]-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine (PubChem CID 89203292) has the molecular formula C17H16ClF5N6O and a molecular weight of 450.80 g/mol. Its IUPAC name is 5-chloro-6-[2,6-difluoro-4-[1-(methylamino)ethoxy]phenyl]-N-[(2S)-1,1,1-trifluoropropan-2-yl]-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | 5-chloro-6-[2,6-difluoro-4-[1-(methylamino)ethoxy]phenyl]-N-[(2S)-1,1,1-trifluoropropan-2-yl]-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 89203292 |
| Molecular Formula | C17H16ClF5N6O |
| Molecular Weight | 450.80 g/mol |
| Exact Mass | 450.10 |
| IUPAC Name | 5-chloro-6-[2,6-difluoro-4-[1-(methylamino)ethoxy]phenyl]-N-[(2S)-1,1,1-trifluoropropan-2-yl]-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
| SMILES | CNC(C)Oc1cc(F)c(-c2c(Cl)nc3ncnn3c2N[C@@H](C)C(F)(F)F)c(F)c1 |
| InChI | InChI=1S/C17H16ClF5N6O/c1-7(17(21,22)23)27-15-13(14(18)28-16-25-6-26-29(15)16)12-10(19)4-9(5-11(12)20)30-8(2)24-3/h4-8,24,27H,1-3H3/t7-,8?/m0/s1 |
| InChIKey | IEPREKNONHAVCC-JAMMHHFISA-N |
| XLogP | 4.03 |
| TPSA | 76.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.80 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|