C21H23ClF2N4O2 — CID 11476094
3-[4-(5-chloro-7-cycloheptyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)-3,5-difluorophenoxy]propan-1-ol (PubChem CID 11476094) has the molecular formula C21H23ClF2N4O2 and a molecular weight of 436.89 g/mol. Its IUPAC name is 3-[4-(5-chloro-7-cycloheptyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)-3,5-difluorophenoxy]propan-1-ol.
| Compound Name | 3-[4-(5-chloro-7-cycloheptyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)-3,5-difluorophenoxy]propan-1-ol |
|---|---|
| PubChem CID | 11476094 |
| Molecular Formula | C21H23ClF2N4O2 |
| Molecular Weight | 436.89 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | 3-[4-(5-chloro-7-cycloheptyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)-3,5-difluorophenoxy]propan-1-ol |
| SMILES | OCCCOc1cc(F)c(-c2c(Cl)nc3ncnn3c2C2CCCCCC2)c(F)c1 |
| InChI | InChI=1S/C21H23ClF2N4O2/c22-20-18(17-15(23)10-14(11-16(17)24)30-9-5-8-29)19(13-6-3-1-2-4-7-13)28-21(27-20)25-12-26-28/h10-13,29H,1-9H2 |
| InChIKey | SILNEJLZHQBBBR-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 72.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.89 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|