C14H10ClF4N — CID 107365097
3-chloro-5-fluoro-N-(2,2,2-trifluoro-1-phenylethyl)aniline (PubChem CID 107365097) has the molecular formula C14H10ClF4N and a molecular weight of 303.69 g/mol. Its IUPAC name is 3-chloro-5-fluoro-N-(2,2,2-trifluoro-1-phenylethyl)aniline.
| Compound Name | 3-chloro-5-fluoro-N-(2,2,2-trifluoro-1-phenylethyl)aniline |
|---|---|
| PubChem CID | 107365097 |
| Molecular Formula | C14H10ClF4N |
| Molecular Weight | 303.69 g/mol |
| Exact Mass | 303.04 |
| IUPAC Name | 3-chloro-5-fluoro-N-(2,2,2-trifluoro-1-phenylethyl)aniline |
| SMILES | Fc1cc(Cl)cc(NC(c2ccccc2)C(F)(F)F)c1 |
| InChI | InChI=1S/C14H10ClF4N/c15-10-6-11(16)8-12(7-10)20-13(14(17,18)19)9-4-2-1-3-5-9/h1-8,13,20H |
| InChIKey | SCSUKYBARQQTMA-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.69 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |