C16H14ClF3N2O — CID 86861058
N-(3-chlorophenyl)-2-[(2,2,2-trifluoro-1-phenylethyl)amino]acetamide (PubChem CID 86861058) has the molecular formula C16H14ClF3N2O and a molecular weight of 342.75 g/mol. Its IUPAC name is N-(3-chlorophenyl)-2-[(2,2,2-trifluoro-1-phenylethyl)amino]acetamide.
| Compound Name | N-(3-chlorophenyl)-2-[(2,2,2-trifluoro-1-phenylethyl)amino]acetamide |
|---|---|
| PubChem CID | 86861058 |
| Molecular Formula | C16H14ClF3N2O |
| Molecular Weight | 342.75 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | N-(3-chlorophenyl)-2-[(2,2,2-trifluoro-1-phenylethyl)amino]acetamide |
| SMILES | O=C(CNC(c1ccccc1)C(F)(F)F)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C16H14ClF3N2O/c17-12-7-4-8-13(9-12)22-14(23)10-21-15(16(18,19)20)11-5-2-1-3-6-11/h1-9,15,21H,10H2,(H,22,23) |
| InChIKey | SNNREPKMLSKINL-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.75 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |