C8H12ClN3 — CID 82468511
3-chloro-2-N-propan-2-ylpyridine-2,5-diamine (PubChem CID 82468511) has the molecular formula C8H12ClN3 and a molecular weight of 185.66 g/mol. Its IUPAC name is 3-chloro-2-N-propan-2-ylpyridine-2,5-diamine.
| Compound Name | 3-chloro-2-N-propan-2-ylpyridine-2,5-diamine |
|---|---|
| PubChem CID | 82468511 |
| Molecular Formula | C8H12ClN3 |
| Molecular Weight | 185.66 g/mol |
| Exact Mass | 185.07 |
| IUPAC Name | 3-chloro-2-N-propan-2-ylpyridine-2,5-diamine |
| SMILES | CC(C)Nc1ncc(N)cc1Cl |
| InChI | InChI=1S/C8H12ClN3/c1-5(2)12-8-7(9)3-6(10)4-11-8/h3-5H,10H2,1-2H3,(H,11,12) |
| InChIKey | DVCNTJHGAOHGAX-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.66 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |