C9H12N4 — CID 60922622
5-amino-2-(propan-2-ylamino)pyridine-3-carbonitrile (PubChem CID 60922622) has the molecular formula C9H12N4 and a molecular weight of 176.22 g/mol. Its IUPAC name is 5-amino-2-(propan-2-ylamino)pyridine-3-carbonitrile.
| Compound Name | 5-amino-2-(propan-2-ylamino)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 60922622 |
| Molecular Formula | C9H12N4 |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.11 |
| IUPAC Name | 5-amino-2-(propan-2-ylamino)pyridine-3-carbonitrile |
| SMILES | CC(C)Nc1ncc(N)cc1C#N |
| InChI | InChI=1S/C9H12N4/c1-6(2)13-9-7(4-10)3-8(11)5-12-9/h3,5-6H,11H2,1-2H3,(H,12,13) |
| InChIKey | MEDSIKCDNOUZLX-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 74.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |