C10H16ClN3O2 — CID 106153927
3-[(5-amino-3-chloro-2-pyridinyl)amino]-4-methoxybutan-1-ol (PubChem CID 106153927) has the molecular formula C10H16ClN3O2 and a molecular weight of 245.71 g/mol. Its IUPAC name is 3-[(5-amino-3-chloro-2-pyridinyl)amino]-4-methoxybutan-1-ol.
| Compound Name | 3-[(5-amino-3-chloro-2-pyridinyl)amino]-4-methoxybutan-1-ol |
|---|---|
| PubChem CID | 106153927 |
| Molecular Formula | C10H16ClN3O2 |
| Molecular Weight | 245.71 g/mol |
| Exact Mass | 245.09 |
| IUPAC Name | 3-[(5-amino-3-chloro-2-pyridinyl)amino]-4-methoxybutan-1-ol |
| SMILES | COCC(CCO)Nc1ncc(N)cc1Cl |
| InChI | InChI=1S/C10H16ClN3O2/c1-16-6-8(2-3-15)14-10-9(11)4-7(12)5-13-10/h4-5,8,15H,2-3,6,12H2,1H3,(H,13,14) |
| InChIKey | MSPDBDMVBHCZOQ-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 80.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.71 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |