C10H16ClN3O3 — CID 106157779
3-[(5-chloro-2-methoxypyrimidin-4-yl)amino]-4-methoxybutan-1-ol (PubChem CID 106157779) has the molecular formula C10H16ClN3O3 and a molecular weight of 261.71 g/mol. Its IUPAC name is 3-[(5-chloro-2-methoxypyrimidin-4-yl)amino]-4-methoxybutan-1-ol.
| Compound Name | 3-[(5-chloro-2-methoxypyrimidin-4-yl)amino]-4-methoxybutan-1-ol |
|---|---|
| PubChem CID | 106157779 |
| Molecular Formula | C10H16ClN3O3 |
| Molecular Weight | 261.71 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | 3-[(5-chloro-2-methoxypyrimidin-4-yl)amino]-4-methoxybutan-1-ol |
| SMILES | COCC(CCO)Nc1nc(OC)ncc1Cl |
| InChI | InChI=1S/C10H16ClN3O3/c1-16-6-7(3-4-15)13-9-8(11)5-12-10(14-9)17-2/h5,7,15H,3-4,6H2,1-2H3,(H,12,13,14) |
| InChIKey | CJDJWUYCSXTNCT-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 76.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.71 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |