C9H13Cl2N3O2 — CID 106181795
5-chloro-N-(1-chloro-3-methoxypropan-2-yl)-2-methoxypyrimidin-4-amine (PubChem CID 106181795) has the molecular formula C9H13Cl2N3O2 and a molecular weight of 266.13 g/mol. Its IUPAC name is 5-chloro-N-(1-chloro-3-methoxypropan-2-yl)-2-methoxypyrimidin-4-amine.
| Compound Name | 5-chloro-N-(1-chloro-3-methoxypropan-2-yl)-2-methoxypyrimidin-4-amine |
|---|---|
| PubChem CID | 106181795 |
| Molecular Formula | C9H13Cl2N3O2 |
| Molecular Weight | 266.13 g/mol |
| Exact Mass | 265.04 |
| IUPAC Name | 5-chloro-N-(1-chloro-3-methoxypropan-2-yl)-2-methoxypyrimidin-4-amine |
| SMILES | COCC(CCl)Nc1nc(OC)ncc1Cl |
| InChI | InChI=1S/C9H13Cl2N3O2/c1-15-5-6(3-10)13-8-7(11)4-12-9(14-8)16-2/h4,6H,3,5H2,1-2H3,(H,12,13,14) |
| InChIKey | OMBURYCPDLVPHQ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.13 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|