C12H16Cl2N2O3 — CID 106151930
5-amino-2,3-dichloro-N-(4-hydroxy-1-methoxybutan-2-yl)benzamide (PubChem CID 106151930) has the molecular formula C12H16Cl2N2O3 and a molecular weight of 307.18 g/mol. Its IUPAC name is 5-amino-2,3-dichloro-N-(4-hydroxy-1-methoxybutan-2-yl)benzamide.
| Compound Name | 5-amino-2,3-dichloro-N-(4-hydroxy-1-methoxybutan-2-yl)benzamide |
|---|---|
| PubChem CID | 106151930 |
| Molecular Formula | C12H16Cl2N2O3 |
| Molecular Weight | 307.18 g/mol |
| Exact Mass | 306.05 |
| IUPAC Name | 5-amino-2,3-dichloro-N-(4-hydroxy-1-methoxybutan-2-yl)benzamide |
| SMILES | COCC(CCO)NC(=O)c1cc(N)cc(Cl)c1Cl |
| InChI | InChI=1S/C12H16Cl2N2O3/c1-19-6-8(2-3-17)16-12(18)9-4-7(15)5-10(13)11(9)14/h4-5,8,17H,2-3,6,15H2,1H3,(H,16,18) |
| InChIKey | JHSWKEJOSXWYIG-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.18 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|