C10H15ClN2O3 — CID 103799622
4-chloro-N-(4-hydroxy-1-methoxybutan-2-yl)-1H-pyrrole-2-carboxamide (PubChem CID 103799622) has the molecular formula C10H15ClN2O3 and a molecular weight of 246.69 g/mol. Its IUPAC name is 4-chloro-N-(4-hydroxy-1-methoxybutan-2-yl)-1H-pyrrole-2-carboxamide.
| Compound Name | 4-chloro-N-(4-hydroxy-1-methoxybutan-2-yl)-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 103799622 |
| Molecular Formula | C10H15ClN2O3 |
| Molecular Weight | 246.69 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | 4-chloro-N-(4-hydroxy-1-methoxybutan-2-yl)-1H-pyrrole-2-carboxamide |
| SMILES | COCC(CCO)NC(=O)c1cc(Cl)c[nH]1 |
| InChI | InChI=1S/C10H15ClN2O3/c1-16-6-8(2-3-14)13-10(15)9-4-7(11)5-12-9/h4-5,8,12,14H,2-3,6H2,1H3,(H,13,15) |
| InChIKey | NVPODRJWKJNKBZ-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 74.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.69 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |