C15H17ClN2O3 — CID 106153342
4-chloro-N-(4-hydroxy-1-methoxybutan-2-yl)quinoline-2-carboxamide (PubChem CID 106153342) has the molecular formula C15H17ClN2O3 and a molecular weight of 308.76 g/mol. Its IUPAC name is 4-chloro-N-(4-hydroxy-1-methoxybutan-2-yl)quinoline-2-carboxamide.
| Compound Name | 4-chloro-N-(4-hydroxy-1-methoxybutan-2-yl)quinoline-2-carboxamide |
|---|---|
| PubChem CID | 106153342 |
| Molecular Formula | C15H17ClN2O3 |
| Molecular Weight | 308.76 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 4-chloro-N-(4-hydroxy-1-methoxybutan-2-yl)quinoline-2-carboxamide |
| SMILES | COCC(CCO)NC(=O)c1cc(Cl)c2ccccc2n1 |
| InChI | InChI=1S/C15H17ClN2O3/c1-21-9-10(6-7-19)17-15(20)14-8-12(16)11-4-2-3-5-13(11)18-14/h2-5,8,10,19H,6-7,9H2,1H3,(H,17,20) |
| InChIKey | KXPXLMMNWLIWEB-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.76 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |