C10H11ClN2O5 — CID 63307372
(2S)-2-[(4-chloro-1H-pyrrole-2-carbonyl)amino]-4-methoxy-4-oxobutanoic acid (PubChem CID 63307372) has the molecular formula C10H11ClN2O5 and a molecular weight of 274.66 g/mol. Its IUPAC name is (2S)-2-[(4-chloro-1H-pyrrole-2-carbonyl)amino]-4-methoxy-4-oxobutanoic acid.
| Compound Name | (2S)-2-[(4-chloro-1H-pyrrole-2-carbonyl)amino]-4-methoxy-4-oxobutanoic acid |
|---|---|
| PubChem CID | 63307372 |
| Molecular Formula | C10H11ClN2O5 |
| Molecular Weight | 274.66 g/mol |
| Exact Mass | 274.04 |
| IUPAC Name | (2S)-2-[(4-chloro-1H-pyrrole-2-carbonyl)amino]-4-methoxy-4-oxobutanoic acid |
| SMILES | COC(=O)C[C@H](NC(=O)c1cc(Cl)c[nH]1)C(=O)O |
| InChI | InChI=1S/C10H11ClN2O5/c1-18-8(14)3-7(10(16)17)13-9(15)6-2-5(11)4-12-6/h2,4,7,12H,3H2,1H3,(H,13,15)(H,16,17)/t7-/m0/s1 |
| InChIKey | ACKLGANUHMNCRJ-ZETCQYMHSA-N |
| XLogP | 0.41 |
| TPSA | 108.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.66 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |