C9H11ClN2O3 — CID 94540993
(2R)-3-[(4-chloro-1H-pyrrole-2-carbonyl)amino]-2-methylpropanoic acid (PubChem CID 94540993) has the molecular formula C9H11ClN2O3 and a molecular weight of 230.65 g/mol. Its IUPAC name is (2R)-3-[(4-chloro-1H-pyrrole-2-carbonyl)amino]-2-methylpropanoic acid.
| Compound Name | (2R)-3-[(4-chloro-1H-pyrrole-2-carbonyl)amino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 94540993 |
| Molecular Formula | C9H11ClN2O3 |
| Molecular Weight | 230.65 g/mol |
| Exact Mass | 230.05 |
| IUPAC Name | (2R)-3-[(4-chloro-1H-pyrrole-2-carbonyl)amino]-2-methylpropanoic acid |
| SMILES | C[C@H](CNC(=O)c1cc(Cl)c[nH]1)C(=O)O |
| InChI | InChI=1S/C9H11ClN2O3/c1-5(9(14)15)3-12-8(13)7-2-6(10)4-11-7/h2,4-5,11H,3H2,1H3,(H,12,13)(H,14,15)/t5-/m1/s1 |
| InChIKey | YLFDANWYVKYJBG-RXMQYKEDSA-N |
| XLogP | 1.12 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.65 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |