C10H13ClN2O3 — CID 28741107
(2R)-2-[(4-chloro-1H-pyrrole-2-carbonyl)amino]-3-methylbutanoic acid (PubChem CID 28741107) has the molecular formula C10H13ClN2O3 and a molecular weight of 244.68 g/mol. Its IUPAC name is (2R)-2-[(4-chloro-1H-pyrrole-2-carbonyl)amino]-3-methylbutanoic acid.
| Compound Name | (2R)-2-[(4-chloro-1H-pyrrole-2-carbonyl)amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 28741107 |
| Molecular Formula | C10H13ClN2O3 |
| Molecular Weight | 244.68 g/mol |
| Exact Mass | 244.06 |
| IUPAC Name | (2R)-2-[(4-chloro-1H-pyrrole-2-carbonyl)amino]-3-methylbutanoic acid |
| SMILES | CC(C)[C@@H](NC(=O)c1cc(Cl)c[nH]1)C(=O)O |
| InChI | InChI=1S/C10H13ClN2O3/c1-5(2)8(10(15)16)13-9(14)7-3-6(11)4-12-7/h3-5,8,12H,1-2H3,(H,13,14)(H,15,16)/t8-/m1/s1 |
| InChIKey | AKOKCGOKLAMLNS-MRVPVSSYSA-N |
| XLogP | 1.51 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.68 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |