C9H13ClN2O2 — CID 104981075
4-chloro-N-[(2S)-1-hydroxybutan-2-yl]-1H-pyrrole-2-carboxamide (PubChem CID 104981075) has the molecular formula C9H13ClN2O2 and a molecular weight of 216.67 g/mol. Its IUPAC name is 4-chloro-N-[(2S)-1-hydroxybutan-2-yl]-1H-pyrrole-2-carboxamide.
| Compound Name | 4-chloro-N-[(2S)-1-hydroxybutan-2-yl]-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 104981075 |
| Molecular Formula | C9H13ClN2O2 |
| Molecular Weight | 216.67 g/mol |
| Exact Mass | 216.07 |
| IUPAC Name | 4-chloro-N-[(2S)-1-hydroxybutan-2-yl]-1H-pyrrole-2-carboxamide |
| SMILES | CC[C@@H](CO)NC(=O)c1cc(Cl)c[nH]1 |
| InChI | InChI=1S/C9H13ClN2O2/c1-2-7(5-13)12-9(14)8-3-6(10)4-11-8/h3-4,7,11,13H,2,5H2,1H3,(H,12,14)/t7-/m0/s1 |
| InChIKey | VNOQDHJBKSHLHQ-ZETCQYMHSA-N |
| XLogP | 1.17 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.67 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |