C9H13N3O4 — CID 43394223
N-(1-hydroxybutan-2-yl)-4-nitro-1H-pyrrole-2-carboxamide (PubChem CID 43394223) has the molecular formula C9H13N3O4 and a molecular weight of 227.22 g/mol. Its IUPAC name is N-(1-hydroxybutan-2-yl)-4-nitro-1H-pyrrole-2-carboxamide.
| Compound Name | N-(1-hydroxybutan-2-yl)-4-nitro-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 43394223 |
| Molecular Formula | C9H13N3O4 |
| Molecular Weight | 227.22 g/mol |
| Exact Mass | 227.09 |
| IUPAC Name | N-(1-hydroxybutan-2-yl)-4-nitro-1H-pyrrole-2-carboxamide |
| SMILES | CCC(CO)NC(=O)c1cc([N+](=O)[O-])c[nH]1 |
| InChI | InChI=1S/C9H13N3O4/c1-2-6(5-13)11-9(14)8-3-7(4-10-8)12(15)16/h3-4,6,10,13H,2,5H2,1H3,(H,11,14) |
| InChIKey | NWSBUEFRPKROHL-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 108.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.22 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|