C9H11N3O6 — CID 28740968
(2S,3R)-3-hydroxy-2-[(4-nitro-1H-pyrrole-2-carbonyl)amino]butanoic acid (PubChem CID 28740968) has the molecular formula C9H11N3O6 and a molecular weight of 257.20 g/mol. Its IUPAC name is (2S,3R)-3-hydroxy-2-[(4-nitro-1H-pyrrole-2-carbonyl)amino]butanoic acid.
| Compound Name | (2S,3R)-3-hydroxy-2-[(4-nitro-1H-pyrrole-2-carbonyl)amino]butanoic acid |
|---|---|
| PubChem CID | 28740968 |
| Molecular Formula | C9H11N3O6 |
| Molecular Weight | 257.20 g/mol |
| Exact Mass | 257.06 |
| IUPAC Name | (2S,3R)-3-hydroxy-2-[(4-nitro-1H-pyrrole-2-carbonyl)amino]butanoic acid |
| SMILES | C[C@@H](O)[C@H](NC(=O)c1cc([N+](=O)[O-])c[nH]1)C(=O)O |
| InChI | InChI=1S/C9H11N3O6/c1-4(13)7(9(15)16)11-8(14)6-2-5(3-10-6)12(17)18/h2-4,7,10,13H,1H3,(H,11,14)(H,15,16)/t4-,7+/m1/s1 |
| InChIKey | GAXGWVOECDYQEE-FBCQKBJTSA-N |
| XLogP | -0.51 |
| TPSA | 145.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.20 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|