C11H17N3O4 — CID 113354459
N-(3-hydroxy-2,3-dimethylbutan-2-yl)-4-nitro-1H-pyrrole-2-carboxamide (PubChem CID 113354459) has the molecular formula C11H17N3O4 and a molecular weight of 255.27 g/mol. Its IUPAC name is N-(3-hydroxy-2,3-dimethylbutan-2-yl)-4-nitro-1H-pyrrole-2-carboxamide.
| Compound Name | N-(3-hydroxy-2,3-dimethylbutan-2-yl)-4-nitro-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 113354459 |
| Molecular Formula | C11H17N3O4 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.12 |
| IUPAC Name | N-(3-hydroxy-2,3-dimethylbutan-2-yl)-4-nitro-1H-pyrrole-2-carboxamide |
| SMILES | CC(C)(O)C(C)(C)NC(=O)c1cc([N+](=O)[O-])c[nH]1 |
| InChI | InChI=1S/C11H17N3O4/c1-10(2,11(3,4)16)13-9(15)8-5-7(6-12-8)14(17)18/h5-6,12,16H,1-4H3,(H,13,15) |
| InChIKey | LJVTUWUGUCMXGJ-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 108.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|