C8H9N3O5 — CID 43408669
methyl 2-[(4-nitro-1H-pyrrole-2-carbonyl)amino]acetate (PubChem CID 43408669) has the molecular formula C8H9N3O5 and a molecular weight of 227.18 g/mol. Its IUPAC name is methyl 2-[(4-nitro-1H-pyrrole-2-carbonyl)amino]acetate.
| Compound Name | methyl 2-[(4-nitro-1H-pyrrole-2-carbonyl)amino]acetate |
|---|---|
| PubChem CID | 43408669 |
| Molecular Formula | C8H9N3O5 |
| Molecular Weight | 227.18 g/mol |
| Exact Mass | 227.05 |
| IUPAC Name | methyl 2-[(4-nitro-1H-pyrrole-2-carbonyl)amino]acetate |
| SMILES | COC(=O)CNC(=O)c1cc([N+](=O)[O-])c[nH]1 |
| InChI | InChI=1S/C8H9N3O5/c1-16-7(12)4-10-8(13)6-2-5(3-9-6)11(14)15/h2-3,9H,4H2,1H3,(H,10,13) |
| InChIKey | QMZVQKIFBJHTST-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 114.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.18 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|