C12H17N3O6 — CID 104964809
(2S,3R)-3-hydroxy-2-[(4-nitro-1-propylpyrrole-2-carbonyl)amino]butanoic acid (PubChem CID 104964809) has the molecular formula C12H17N3O6 and a molecular weight of 299.28 g/mol. Its IUPAC name is (2S,3R)-3-hydroxy-2-[(4-nitro-1-propylpyrrole-2-carbonyl)amino]butanoic acid.
| Compound Name | (2S,3R)-3-hydroxy-2-[(4-nitro-1-propylpyrrole-2-carbonyl)amino]butanoic acid |
|---|---|
| PubChem CID | 104964809 |
| Molecular Formula | C12H17N3O6 |
| Molecular Weight | 299.28 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | (2S,3R)-3-hydroxy-2-[(4-nitro-1-propylpyrrole-2-carbonyl)amino]butanoic acid |
| SMILES | CCCn1cc([N+](=O)[O-])cc1C(=O)N[C@H](C(=O)O)[C@@H](C)O |
| InChI | InChI=1S/C12H17N3O6/c1-3-4-14-6-8(15(20)21)5-9(14)11(17)13-10(7(2)16)12(18)19/h5-7,10,16H,3-4H2,1-2H3,(H,13,17)(H,18,19)/t7-,10+/m1/s1 |
| InChIKey | WECAKWOKVNWHIX-XCBNKYQSSA-N |
| XLogP | 0.37 |
| TPSA | 134.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.28 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|