C11H15N3O6 — CID 61153534
(2S)-3-hydroxy-2-[(4-nitro-1-propylpyrrole-2-carbonyl)amino]propanoic acid (PubChem CID 61153534) has the molecular formula C11H15N3O6 and a molecular weight of 285.26 g/mol. Its IUPAC name is (2S)-3-hydroxy-2-[(4-nitro-1-propylpyrrole-2-carbonyl)amino]propanoic acid.
| Compound Name | (2S)-3-hydroxy-2-[(4-nitro-1-propylpyrrole-2-carbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 61153534 |
| Molecular Formula | C11H15N3O6 |
| Molecular Weight | 285.26 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | (2S)-3-hydroxy-2-[(4-nitro-1-propylpyrrole-2-carbonyl)amino]propanoic acid |
| SMILES | CCCn1cc([N+](=O)[O-])cc1C(=O)N[C@@H](CO)C(=O)O |
| InChI | InChI=1S/C11H15N3O6/c1-2-3-13-5-7(14(19)20)4-9(13)10(16)12-8(6-15)11(17)18/h4-5,8,15H,2-3,6H2,1H3,(H,12,16)(H,17,18)/t8-/m0/s1 |
| InChIKey | GVVMJOMPXMBJPX-QMMMGPOBSA-N |
| XLogP | -0.02 |
| TPSA | 134.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.26 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|