C14H23N3O4 — CID 65112364
N-(2-ethyl-2-hydroxybutyl)-4-nitro-1-propylpyrrole-2-carboxamide (PubChem CID 65112364) has the molecular formula C14H23N3O4 and a molecular weight of 297.36 g/mol. Its IUPAC name is N-(2-ethyl-2-hydroxybutyl)-4-nitro-1-propylpyrrole-2-carboxamide.
| Compound Name | N-(2-ethyl-2-hydroxybutyl)-4-nitro-1-propylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 65112364 |
| Molecular Formula | C14H23N3O4 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | N-(2-ethyl-2-hydroxybutyl)-4-nitro-1-propylpyrrole-2-carboxamide |
| SMILES | CCCn1cc([N+](=O)[O-])cc1C(=O)NCC(O)(CC)CC |
| InChI | InChI=1S/C14H23N3O4/c1-4-7-16-9-11(17(20)21)8-12(16)13(18)15-10-14(19,5-2)6-3/h8-9,19H,4-7,10H2,1-3H3,(H,15,18) |
| InChIKey | LOCBJBFKJBQLLE-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 97.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|