C12H20N4O3 — CID 63193894
N-(1-amino-2-methylpropan-2-yl)-4-nitro-1-propylpyrrole-2-carboxamide (PubChem CID 63193894) has the molecular formula C12H20N4O3 and a molecular weight of 268.32 g/mol. Its IUPAC name is N-(1-amino-2-methylpropan-2-yl)-4-nitro-1-propylpyrrole-2-carboxamide.
| Compound Name | N-(1-amino-2-methylpropan-2-yl)-4-nitro-1-propylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 63193894 |
| Molecular Formula | C12H20N4O3 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | N-(1-amino-2-methylpropan-2-yl)-4-nitro-1-propylpyrrole-2-carboxamide |
| SMILES | CCCn1cc([N+](=O)[O-])cc1C(=O)NC(C)(C)CN |
| InChI | InChI=1S/C12H20N4O3/c1-4-5-15-7-9(16(18)19)6-10(15)11(17)14-12(2,3)8-13/h6-7H,4-5,8,13H2,1-3H3,(H,14,17) |
| InChIKey | AZMCUTGNLYJYQQ-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 103.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|