C14H14IN3O3 — CID 61400273
N-(4-iodophenyl)-4-nitro-1-propylpyrrole-2-carboxamide (PubChem CID 61400273) has the molecular formula C14H14IN3O3 and a molecular weight of 399.19 g/mol. Its IUPAC name is N-(4-iodophenyl)-4-nitro-1-propylpyrrole-2-carboxamide.
| Compound Name | N-(4-iodophenyl)-4-nitro-1-propylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 61400273 |
| Molecular Formula | C14H14IN3O3 |
| Molecular Weight | 399.19 g/mol |
| Exact Mass | 399.01 |
| IUPAC Name | N-(4-iodophenyl)-4-nitro-1-propylpyrrole-2-carboxamide |
| SMILES | CCCn1cc([N+](=O)[O-])cc1C(=O)Nc1ccc(I)cc1 |
| InChI | InChI=1S/C14H14IN3O3/c1-2-7-17-9-12(18(20)21)8-13(17)14(19)16-11-5-3-10(15)4-6-11/h3-6,8-9H,2,7H2,1H3,(H,16,19) |
| InChIKey | CAGSLRAUYQKQFQ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 77.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.19 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|