C11H15ClN2O3 — CID 30064551
(2R)-2-[(4-chloro-1H-pyrrole-2-carbonyl)amino]-4-methylpentanoic acid (PubChem CID 30064551) has the molecular formula C11H15ClN2O3 and a molecular weight of 258.70 g/mol. Its IUPAC name is (2R)-2-[(4-chloro-1H-pyrrole-2-carbonyl)amino]-4-methylpentanoic acid.
| Compound Name | (2R)-2-[(4-chloro-1H-pyrrole-2-carbonyl)amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 30064551 |
| Molecular Formula | C11H15ClN2O3 |
| Molecular Weight | 258.70 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | (2R)-2-[(4-chloro-1H-pyrrole-2-carbonyl)amino]-4-methylpentanoic acid |
| SMILES | CC(C)C[C@@H](NC(=O)c1cc(Cl)c[nH]1)C(=O)O |
| InChI | InChI=1S/C11H15ClN2O3/c1-6(2)3-9(11(16)17)14-10(15)8-4-7(12)5-13-8/h4-6,9,13H,3H2,1-2H3,(H,14,15)(H,16,17)/t9-/m1/s1 |
| InChIKey | XARUEOQYHVPLMU-SECBINFHSA-N |
| XLogP | 1.90 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.70 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |