C13H12Cl2N2O — CID 134012860
4-chloro-N-[1-(2-chlorophenyl)ethyl]-1H-pyrrole-2-carboxamide (PubChem CID 134012860) has the molecular formula C13H12Cl2N2O and a molecular weight of 283.16 g/mol. Its IUPAC name is 4-chloro-N-[1-(2-chlorophenyl)ethyl]-1H-pyrrole-2-carboxamide.
| Compound Name | 4-chloro-N-[1-(2-chlorophenyl)ethyl]-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 134012860 |
| Molecular Formula | C13H12Cl2N2O |
| Molecular Weight | 283.16 g/mol |
| Exact Mass | 282.03 |
| IUPAC Name | 4-chloro-N-[1-(2-chlorophenyl)ethyl]-1H-pyrrole-2-carboxamide |
| SMILES | CC(NC(=O)c1cc(Cl)c[nH]1)c1ccccc1Cl |
| InChI | InChI=1S/C13H12Cl2N2O/c1-8(10-4-2-3-5-11(10)15)17-13(18)12-6-9(14)7-16-12/h2-8,16H,1H3,(H,17,18) |
| InChIKey | XRCUTMWWDQNNAU-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.16 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |