C14H14BrClN4O2 — CID 25444239
1-[(4-bromo-1H-pyrrole-2-carbonyl)amino]-3-[(1S)-1-(2-chlorophenyl)ethyl]urea (PubChem CID 25444239) has the molecular formula C14H14BrClN4O2 and a molecular weight of 385.65 g/mol. Its IUPAC name is 1-[(4-bromo-1H-pyrrole-2-carbonyl)amino]-3-[(1S)-1-(2-chlorophenyl)ethyl]urea.
| Compound Name | 1-[(4-bromo-1H-pyrrole-2-carbonyl)amino]-3-[(1S)-1-(2-chlorophenyl)ethyl]urea |
|---|---|
| PubChem CID | 25444239 |
| Molecular Formula | C14H14BrClN4O2 |
| Molecular Weight | 385.65 g/mol |
| Exact Mass | 384.00 |
| IUPAC Name | 1-[(4-bromo-1H-pyrrole-2-carbonyl)amino]-3-[(1S)-1-(2-chlorophenyl)ethyl]urea |
| SMILES | C[C@H](NC(=O)NNC(=O)c1cc(Br)c[nH]1)c1ccccc1Cl |
| InChI | InChI=1S/C14H14BrClN4O2/c1-8(10-4-2-3-5-11(10)16)18-14(22)20-19-13(21)12-6-9(15)7-17-12/h2-8,17H,1H3,(H,19,21)(H2,18,20,22)/t8-/m0/s1 |
| InChIKey | QALBOTZIUMRWGV-QMMMGPOBSA-N |
| XLogP | 3.14 |
| TPSA | 86.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.65 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|