C13H12Br2N2O — CID 93317785
4-bromo-N-[(1R)-1-(4-bromophenyl)ethyl]-1H-pyrrole-2-carboxamide (PubChem CID 93317785) has the molecular formula C13H12Br2N2O and a molecular weight of 372.06 g/mol. Its IUPAC name is 4-bromo-N-[(1R)-1-(4-bromophenyl)ethyl]-1H-pyrrole-2-carboxamide.
| Compound Name | 4-bromo-N-[(1R)-1-(4-bromophenyl)ethyl]-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 93317785 |
| Molecular Formula | C13H12Br2N2O |
| Molecular Weight | 372.06 g/mol |
| Exact Mass | 369.93 |
| IUPAC Name | 4-bromo-N-[(1R)-1-(4-bromophenyl)ethyl]-1H-pyrrole-2-carboxamide |
| SMILES | C[C@@H](NC(=O)c1cc(Br)c[nH]1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C13H12Br2N2O/c1-8(9-2-4-10(14)5-3-9)17-13(18)12-6-11(15)7-16-12/h2-8,16H,1H3,(H,17,18)/t8-/m1/s1 |
| InChIKey | VNMDYFCCDATUKM-MRVPVSSYSA-N |
| XLogP | 4.03 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.06 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |