C17H18BrN3O2 — CID 134021153
4-bromo-N-[1-[4-(cyclopropanecarbonylamino)phenyl]ethyl]-1H-pyrrole-2-carboxamide (PubChem CID 134021153) has the molecular formula C17H18BrN3O2 and a molecular weight of 376.25 g/mol. Its IUPAC name is 4-bromo-N-[1-[4-(cyclopropanecarbonylamino)phenyl]ethyl]-1H-pyrrole-2-carboxamide.
| Compound Name | 4-bromo-N-[1-[4-(cyclopropanecarbonylamino)phenyl]ethyl]-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 134021153 |
| Molecular Formula | C17H18BrN3O2 |
| Molecular Weight | 376.25 g/mol |
| Exact Mass | 375.06 |
| IUPAC Name | 4-bromo-N-[1-[4-(cyclopropanecarbonylamino)phenyl]ethyl]-1H-pyrrole-2-carboxamide |
| SMILES | CC(NC(=O)c1cc(Br)c[nH]1)c1ccc(NC(=O)C2CC2)cc1 |
| InChI | InChI=1S/C17H18BrN3O2/c1-10(20-17(23)15-8-13(18)9-19-15)11-4-6-14(7-5-11)21-16(22)12-2-3-12/h4-10,12,19H,2-3H2,1H3,(H,20,23)(H,21,22) |
| InChIKey | YAXVIXSFLYXAQW-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.25 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |