C10H13ClN2O4 — CID 66001912
4-[(4-chloro-1H-pyrrole-2-carbonyl)amino]-3-hydroxy-3-methylbutanoic acid (PubChem CID 66001912) has the molecular formula C10H13ClN2O4 and a molecular weight of 260.68 g/mol. Its IUPAC name is 4-[(4-chloro-1H-pyrrole-2-carbonyl)amino]-3-hydroxy-3-methylbutanoic acid.
| Compound Name | 4-[(4-chloro-1H-pyrrole-2-carbonyl)amino]-3-hydroxy-3-methylbutanoic acid |
|---|---|
| PubChem CID | 66001912 |
| Molecular Formula | C10H13ClN2O4 |
| Molecular Weight | 260.68 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | 4-[(4-chloro-1H-pyrrole-2-carbonyl)amino]-3-hydroxy-3-methylbutanoic acid |
| SMILES | CC(O)(CNC(=O)c1cc(Cl)c[nH]1)CC(=O)O |
| InChI | InChI=1S/C10H13ClN2O4/c1-10(17,3-8(14)15)5-13-9(16)7-2-6(11)4-12-7/h2,4,12,17H,3,5H2,1H3,(H,13,16)(H,14,15) |
| InChIKey | AVHKTGFOGKKHQH-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.68 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |