C13H21ClN4 — CID 114046187
3-chloro-2-N-(2-piperidin-1-ylpropyl)pyridine-2,5-diamine (PubChem CID 114046187) has the molecular formula C13H21ClN4 and a molecular weight of 268.79 g/mol. Its IUPAC name is 3-chloro-2-N-(2-piperidin-1-ylpropyl)pyridine-2,5-diamine.
| Compound Name | 3-chloro-2-N-(2-piperidin-1-ylpropyl)pyridine-2,5-diamine |
|---|---|
| PubChem CID | 114046187 |
| Molecular Formula | C13H21ClN4 |
| Molecular Weight | 268.79 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | 3-chloro-2-N-(2-piperidin-1-ylpropyl)pyridine-2,5-diamine |
| SMILES | CC(CNc1ncc(N)cc1Cl)N1CCCCC1 |
| InChI | InChI=1S/C13H21ClN4/c1-10(18-5-3-2-4-6-18)8-16-13-12(14)7-11(15)9-17-13/h7,9-10H,2-6,8,15H2,1H3,(H,16,17) |
| InChIKey | QTBKEMUIGGPTCA-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.79 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |