C13H19Cl2N3 — CID 54899459
3,5-dichloro-N-(2-piperidin-1-ylpropyl)pyridin-2-amine (PubChem CID 54899459) has the molecular formula C13H19Cl2N3 and a molecular weight of 288.22 g/mol. Its IUPAC name is 3,5-dichloro-N-(2-piperidin-1-ylpropyl)pyridin-2-amine.
| Compound Name | 3,5-dichloro-N-(2-piperidin-1-ylpropyl)pyridin-2-amine |
|---|---|
| PubChem CID | 54899459 |
| Molecular Formula | C13H19Cl2N3 |
| Molecular Weight | 288.22 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | 3,5-dichloro-N-(2-piperidin-1-ylpropyl)pyridin-2-amine |
| SMILES | CC(CNc1ncc(Cl)cc1Cl)N1CCCCC1 |
| InChI | InChI=1S/C13H19Cl2N3/c1-10(18-5-3-2-4-6-18)8-16-13-12(15)7-11(14)9-17-13/h7,9-10H,2-6,8H2,1H3,(H,16,17) |
| InChIKey | IMQCBZANVULZNT-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.22 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |