C16H23N5 — CID 102983851
3-N-(2-piperidin-1-ylpropyl)quinoxaline-2,3-diamine (PubChem CID 102983851) has the molecular formula C16H23N5 and a molecular weight of 285.39 g/mol. Its IUPAC name is 3-N-(2-piperidin-1-ylpropyl)quinoxaline-2,3-diamine.
| Compound Name | 3-N-(2-piperidin-1-ylpropyl)quinoxaline-2,3-diamine |
|---|---|
| PubChem CID | 102983851 |
| Molecular Formula | C16H23N5 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.20 |
| IUPAC Name | 3-N-(2-piperidin-1-ylpropyl)quinoxaline-2,3-diamine |
| SMILES | CC(CNc1nc2ccccc2nc1N)N1CCCCC1 |
| InChI | InChI=1S/C16H23N5/c1-12(21-9-5-2-6-10-21)11-18-16-15(17)19-13-7-3-4-8-14(13)20-16/h3-4,7-8,12H,2,5-6,9-11H2,1H3,(H2,17,19)(H,18,20) |
| InChIKey | CPEOFEJBZCAGAZ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |