C8H10ClN5 — CID 20510226
4-amino-6-chloro-2-(propan-2-ylamino)pyrimidine-5-carbonitrile (PubChem CID 20510226) has the molecular formula C8H10ClN5 and a molecular weight of 211.66 g/mol. Its IUPAC name is 4-amino-6-chloro-2-(propan-2-ylamino)pyrimidine-5-carbonitrile.
| Compound Name | 4-amino-6-chloro-2-(propan-2-ylamino)pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 20510226 |
| Molecular Formula | C8H10ClN5 |
| Molecular Weight | 211.66 g/mol |
| Exact Mass | 211.06 |
| IUPAC Name | 4-amino-6-chloro-2-(propan-2-ylamino)pyrimidine-5-carbonitrile |
| SMILES | CC(C)Nc1nc(N)c(C#N)c(Cl)n1 |
| InChI | InChI=1S/C8H10ClN5/c1-4(2)12-8-13-6(9)5(3-10)7(11)14-8/h4H,1-2H3,(H3,11,12,13,14) |
| InChIKey | ZGIOBPVLKOKYOK-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 87.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.66 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |