C9H18N6 — CID 27784
2-N,4-N-di(propan-2-yl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 27784) has the molecular formula C9H18N6 and a molecular weight of 210.28 g/mol. Its IUPAC name is 2-N,4-N-di(propan-2-yl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N,4-N-di(propan-2-yl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 27784 |
| Molecular Formula | C9H18N6 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.16 |
| IUPAC Name | 2-N,4-N-di(propan-2-yl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | CC(C)Nc1nc(N)nc(NC(C)C)n1 |
| InChI | InChI=1S/C9H18N6/c1-5(2)11-8-13-7(10)14-9(15-8)12-6(3)4/h5-6H,1-4H3,(H4,10,11,12,13,14,15) |
| InChIKey | YNLOWUSCXIJRCB-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 88.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |