C10H18N6O — CID 647855
4,6-bis(propan-2-ylamino)-1,3,5-triazine-2-carboxamide (PubChem CID 647855) has the molecular formula C10H18N6O and a molecular weight of 238.29 g/mol. Its IUPAC name is 4,6-bis(propan-2-ylamino)-1,3,5-triazine-2-carboxamide.
| Compound Name | 4,6-bis(propan-2-ylamino)-1,3,5-triazine-2-carboxamide |
|---|---|
| PubChem CID | 647855 |
| Molecular Formula | C10H18N6O |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | 4,6-bis(propan-2-ylamino)-1,3,5-triazine-2-carboxamide |
| SMILES | CC(C)Nc1nc(NC(C)C)nc(C(N)=O)n1 |
| InChI | InChI=1S/C10H18N6O/c1-5(2)12-9-14-8(7(11)17)15-10(16-9)13-6(3)4/h5-6H,1-4H3,(H2,11,17)(H2,12,13,14,15,16) |
| InChIKey | HPQPVSNCLXSJKI-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 105.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |