C10H14Cl3N5O — CID 20531559
1,1-dichloro-3-[[4-chloro-6-(propan-2-ylamino)-1,3,5-triazin-2-yl]amino]butan-2-one (PubChem CID 20531559) has the molecular formula C10H14Cl3N5O and a molecular weight of 326.62 g/mol. Its IUPAC name is 1,1-dichloro-3-[[4-chloro-6-(propan-2-ylamino)-1,3,5-triazin-2-yl]amino]butan-2-one.
| Compound Name | 1,1-dichloro-3-[[4-chloro-6-(propan-2-ylamino)-1,3,5-triazin-2-yl]amino]butan-2-one |
|---|---|
| PubChem CID | 20531559 |
| Molecular Formula | C10H14Cl3N5O |
| Molecular Weight | 326.62 g/mol |
| Exact Mass | 325.03 |
| IUPAC Name | 1,1-dichloro-3-[[4-chloro-6-(propan-2-ylamino)-1,3,5-triazin-2-yl]amino]butan-2-one |
| SMILES | CC(C)Nc1nc(Cl)nc(NC(C)C(=O)C(Cl)Cl)n1 |
| InChI | InChI=1S/C10H14Cl3N5O/c1-4(2)14-9-16-8(13)17-10(18-9)15-5(3)6(19)7(11)12/h4-5,7H,1-3H3,(H2,14,15,16,17,18) |
| InChIKey | RDMGOPNGKXFZBW-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.62 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|