C8H14ClN5S — CID 21434513
2-[[4-chloro-6-(propan-2-ylamino)-1,3,5-triazin-2-yl]amino]ethanethiol (PubChem CID 21434513) has the molecular formula C8H14ClN5S and a molecular weight of 247.75 g/mol. Its IUPAC name is 2-[[4-chloro-6-(propan-2-ylamino)-1,3,5-triazin-2-yl]amino]ethanethiol.
| Compound Name | 2-[[4-chloro-6-(propan-2-ylamino)-1,3,5-triazin-2-yl]amino]ethanethiol |
|---|---|
| PubChem CID | 21434513 |
| Molecular Formula | C8H14ClN5S |
| Molecular Weight | 247.75 g/mol |
| Exact Mass | 247.07 |
| IUPAC Name | 2-[[4-chloro-6-(propan-2-ylamino)-1,3,5-triazin-2-yl]amino]ethanethiol |
| SMILES | CC(C)Nc1nc(Cl)nc(NCCS)n1 |
| InChI | InChI=1S/C8H14ClN5S/c1-5(2)11-8-13-6(9)12-7(14-8)10-3-4-15/h5,15H,3-4H2,1-2H3,(H2,10,11,12,13,14) |
| InChIKey | WMNBXFJIJRRDOR-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.75 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|