C13H24ClN5 — CID 154289566
6-chloro-2-N,4-N-bis(3-methylbutyl)-1,3,5-triazine-2,4-diamine (PubChem CID 154289566) has the molecular formula C13H24ClN5 and a molecular weight of 285.82 g/mol. Its IUPAC name is 6-chloro-2-N,4-N-bis(3-methylbutyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-chloro-2-N,4-N-bis(3-methylbutyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 154289566 |
| Molecular Formula | C13H24ClN5 |
| Molecular Weight | 285.82 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | 6-chloro-2-N,4-N-bis(3-methylbutyl)-1,3,5-triazine-2,4-diamine |
| SMILES | CC(C)CCNc1nc(Cl)nc(NCCC(C)C)n1 |
| InChI | InChI=1S/C13H24ClN5/c1-9(2)5-7-15-12-17-11(14)18-13(19-12)16-8-6-10(3)4/h9-10H,5-8H2,1-4H3,(H2,15,16,17,18,19) |
| InChIKey | UHMGMWPJXAKMRM-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.82 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |