C7H11ClN4 — CID 110190836
4-chloro-6-methyl-N-propan-2-yl-1,3,5-triazin-2-amine (PubChem CID 110190836) has the molecular formula C7H11ClN4 and a molecular weight of 186.65 g/mol. Its IUPAC name is 4-chloro-6-methyl-N-propan-2-yl-1,3,5-triazin-2-amine.
| Compound Name | 4-chloro-6-methyl-N-propan-2-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 110190836 |
| Molecular Formula | C7H11ClN4 |
| Molecular Weight | 186.65 g/mol |
| Exact Mass | 186.07 |
| IUPAC Name | 4-chloro-6-methyl-N-propan-2-yl-1,3,5-triazin-2-amine |
| SMILES | Cc1nc(Cl)nc(NC(C)C)n1 |
| InChI | InChI=1S/C7H11ClN4/c1-4(2)9-7-11-5(3)10-6(8)12-7/h4H,1-3H3,(H,9,10,11,12) |
| InChIKey | WTJLEHFWXMUASQ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.65 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |