C8H12ClN3 — CID 53385565
4-chloro-6-methyl-N-propan-2-ylpyrimidin-2-amine (PubChem CID 53385565) has the molecular formula C8H12ClN3 and a molecular weight of 185.66 g/mol. Its IUPAC name is 4-chloro-6-methyl-N-propan-2-ylpyrimidin-2-amine.
| Compound Name | 4-chloro-6-methyl-N-propan-2-ylpyrimidin-2-amine |
|---|---|
| PubChem CID | 53385565 |
| Molecular Formula | C8H12ClN3 |
| Molecular Weight | 185.66 g/mol |
| Exact Mass | 185.07 |
| IUPAC Name | 4-chloro-6-methyl-N-propan-2-ylpyrimidin-2-amine |
| SMILES | Cc1cc(Cl)nc(NC(C)C)n1 |
| InChI | InChI=1S/C8H12ClN3/c1-5(2)10-8-11-6(3)4-7(9)12-8/h4-5H,1-3H3,(H,10,11,12) |
| InChIKey | QUEOPLZPFJUQNV-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.66 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |