C21H32N6O — CID 174613758
2,4-bis[6-methyl-2-(propan-2-ylamino)pyrimidin-4-yl]pentan-3-one (PubChem CID 174613758) has the molecular formula C21H32N6O and a molecular weight of 384.53 g/mol. Its IUPAC name is 2,4-bis[6-methyl-2-(propan-2-ylamino)pyrimidin-4-yl]pentan-3-one.
| Compound Name | 2,4-bis[6-methyl-2-(propan-2-ylamino)pyrimidin-4-yl]pentan-3-one |
|---|---|
| PubChem CID | 174613758 |
| Molecular Formula | C21H32N6O |
| Molecular Weight | 384.53 g/mol |
| Exact Mass | 384.26 |
| IUPAC Name | 2,4-bis[6-methyl-2-(propan-2-ylamino)pyrimidin-4-yl]pentan-3-one |
| SMILES | Cc1cc(C(C)C(=O)C(C)c2cc(C)nc(NC(C)C)n2)nc(NC(C)C)n1 |
| InChI | InChI=1S/C21H32N6O/c1-11(2)22-20-24-13(5)9-17(26-20)15(7)19(28)16(8)18-10-14(6)25-21(27-18)23-12(3)4/h9-12,15-16H,1-8H3,(H,22,24,26)(H,23,25,27) |
| InChIKey | DRWZYSPTOGHGNQ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 92.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.53 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |