C11H13ClN6 — CID 141370170
6-(6-chloro-2-pyridinyl)-2-N-propan-2-yl-1,3,5-triazine-2,4-diamine (PubChem CID 141370170) has the molecular formula C11H13ClN6 and a molecular weight of 264.72 g/mol. Its IUPAC name is 6-(6-chloro-2-pyridinyl)-2-N-propan-2-yl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(6-chloro-2-pyridinyl)-2-N-propan-2-yl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 141370170 |
| Molecular Formula | C11H13ClN6 |
| Molecular Weight | 264.72 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | 6-(6-chloro-2-pyridinyl)-2-N-propan-2-yl-1,3,5-triazine-2,4-diamine |
| SMILES | CC(C)Nc1nc(N)nc(-c2cccc(Cl)n2)n1 |
| InChI | InChI=1S/C11H13ClN6/c1-6(2)14-11-17-9(16-10(13)18-11)7-4-3-5-8(12)15-7/h3-6H,1-2H3,(H3,13,14,16,17,18) |
| InChIKey | SEFAMNYFRLQULI-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 89.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.72 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|