C14H10ClF9N6 — CID 123884185
6-(6-chloro-2-pyridinyl)-2-N-(1,1,1,3,3,3-hexafluoropropan-2-yl)-4-N-(1,1,1-trifluoropropan-2-yl)-1,3,5-triazine-2,4-diamine (PubChem CID 123884185) has the molecular formula C14H10ClF9N6 and a molecular weight of 468.71 g/mol. Its IUPAC name is 6-(6-chloro-2-pyridinyl)-2-N-(1,1,1,3,3,3-hexafluoropropan-2-yl)-4-N-(1,1,1-trifluoropropan-2-yl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(6-chloro-2-pyridinyl)-2-N-(1,1,1,3,3,3-hexafluoropropan-2-yl)-4-N-(1,1,1-trifluoropropan-2-yl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 123884185 |
| Molecular Formula | C14H10ClF9N6 |
| Molecular Weight | 468.71 g/mol |
| Exact Mass | 468.05 |
| IUPAC Name | 6-(6-chloro-2-pyridinyl)-2-N-(1,1,1,3,3,3-hexafluoropropan-2-yl)-4-N-(1,1,1-trifluoropropan-2-yl)-1,3,5-triazine-2,4-diamine |
| SMILES | CC(Nc1nc(NC(C(F)(F)F)C(F)(F)F)nc(-c2cccc(Cl)n2)n1)C(F)(F)F |
| InChI | InChI=1S/C14H10ClF9N6/c1-5(12(16,17)18)25-10-27-8(6-3-2-4-7(15)26-6)28-11(30-10)29-9(13(19,20)21)14(22,23)24/h2-5,9H,1H3,(H2,25,27,28,29,30) |
| InChIKey | VTJODCQTJUKOPV-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 75.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.71 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|