C17H22ClF3N6 — CID 138580111
6-(6-chloro-2-pyridinyl)-2-N-(2-methylbutan-2-yl)-4-N-[(2S)-1,1,1-trifluorobutan-2-yl]-1,3,5-triazine-2,4-diamine (PubChem CID 138580111) has the molecular formula C17H22ClF3N6 and a molecular weight of 402.85 g/mol. Its IUPAC name is 6-(6-chloro-2-pyridinyl)-2-N-(2-methylbutan-2-yl)-4-N-[(2S)-1,1,1-trifluorobutan-2-yl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(6-chloro-2-pyridinyl)-2-N-(2-methylbutan-2-yl)-4-N-[(2S)-1,1,1-trifluorobutan-2-yl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 138580111 |
| Molecular Formula | C17H22ClF3N6 |
| Molecular Weight | 402.85 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | 6-(6-chloro-2-pyridinyl)-2-N-(2-methylbutan-2-yl)-4-N-[(2S)-1,1,1-trifluorobutan-2-yl]-1,3,5-triazine-2,4-diamine |
| SMILES | CC[C@H](Nc1nc(NC(C)(C)CC)nc(-c2cccc(Cl)n2)n1)C(F)(F)F |
| InChI | InChI=1S/C17H22ClF3N6/c1-5-11(17(19,20)21)23-14-24-13(10-8-7-9-12(18)22-10)25-15(26-14)27-16(3,4)6-2/h7-9,11H,5-6H2,1-4H3,(H2,23,24,25,26,27)/t11-/m0/s1 |
| InChIKey | HMNRDBRTHGARRX-NSHDSACASA-N |
| XLogP | 4.94 |
| TPSA | 75.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.85 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|