C17H18ClF5N6 — CID 122440806
6-(6-chloro-2-pyridinyl)-4-N-(4,4-difluorocyclohexyl)-2-N-[(2R)-1,1,1-trifluoropropan-2-yl]-1,3,5-triazine-2,4-diamine (PubChem CID 122440806) has the molecular formula C17H18ClF5N6 and a molecular weight of 436.82 g/mol. Its IUPAC name is 6-(6-chloro-2-pyridinyl)-4-N-(4,4-difluorocyclohexyl)-2-N-[(2R)-1,1,1-trifluoropropan-2-yl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(6-chloro-2-pyridinyl)-4-N-(4,4-difluorocyclohexyl)-2-N-[(2R)-1,1,1-trifluoropropan-2-yl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 122440806 |
| Molecular Formula | C17H18ClF5N6 |
| Molecular Weight | 436.82 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | 6-(6-chloro-2-pyridinyl)-4-N-(4,4-difluorocyclohexyl)-2-N-[(2R)-1,1,1-trifluoropropan-2-yl]-1,3,5-triazine-2,4-diamine |
| SMILES | C[C@@H](Nc1nc(NC2CCC(F)(F)CC2)nc(-c2cccc(Cl)n2)n1)C(F)(F)F |
| InChI | InChI=1S/C17H18ClF5N6/c1-9(17(21,22)23)24-14-27-13(11-3-2-4-12(18)26-11)28-15(29-14)25-10-5-7-16(19,20)8-6-10/h2-4,9-10H,5-8H2,1H3,(H2,24,25,27,28,29)/t9-/m1/s1 |
| InChIKey | PJGYBINRKDUCKQ-SECBINFHSA-N |
| XLogP | 4.94 |
| TPSA | 75.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.82 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|